C24H18ClFN2O4 — CID 2888942
3-[3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 2888942) has the molecular formula C24H18ClFN2O4 and a molecular weight of 452.87 g/mol. Its IUPAC name is 3-[3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | 3-[3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2888942 |
| Molecular Formula | C24H18ClFN2O4 |
| Molecular Weight | 452.87 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 3-[3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | COc1cc(C=C(C#N)C(=O)Nc2ccc(O)cc2)cc(Cl)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C24H18ClFN2O4/c1-31-22-12-16(9-17(13-27)24(30)28-19-5-7-20(29)8-6-19)11-21(25)23(22)32-14-15-3-2-4-18(26)10-15/h2-12,29H,14H2,1H3,(H,28,30) |
| InChIKey | DYVNNZVHLIQMHV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.87 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|