C26H20ClN2O5- — CID 7129877
4-[[2-chloro-4-[(E)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-6-methoxyphenoxy]methyl]benzoate (PubChem CID 7129877) has the molecular formula C26H20ClN2O5- and a molecular weight of 475.91 g/mol. Its IUPAC name is 4-[[2-chloro-4-[(E)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-6-methoxyphenoxy]methyl]benzoate.
| Compound Name | 4-[[2-chloro-4-[(E)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-6-methoxyphenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 7129877 |
| Molecular Formula | C26H20ClN2O5- |
| Molecular Weight | 475.91 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 4-[[2-chloro-4-[(E)-2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-6-methoxyphenoxy]methyl]benzoate |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2ccc(C)cc2)cc(Cl)c1OCc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C26H21ClN2O5/c1-16-3-9-21(10-4-16)29-25(30)20(14-28)11-18-12-22(27)24(23(13-18)33-2)34-15-17-5-7-19(8-6-17)26(31)32/h3-13H,15H2,1-2H3,(H,29,30)(H,31,32)/p-1/b20-11+ |
| InChIKey | IZCWGMUKKMUGJA-RGVLZGJSSA-M |
| XLogP | 4.15 |
| TPSA | 111.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.91 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|