C25H20Cl2N2O3 — CID 6079925
(E)-2-cyano-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-methylphenyl)prop-2-enamide (PubChem CID 6079925) has the molecular formula C25H20Cl2N2O3 and a molecular weight of 467.35 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6079925 |
| Molecular Formula | C25H20Cl2N2O3 |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | (E)-2-cyano-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-methylphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2ccc(C)cc2)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H20Cl2N2O3/c1-16-3-7-20(8-4-16)29-25(30)19(14-28)11-17-6-10-23(24(13-17)31-2)32-15-18-5-9-21(26)22(27)12-18/h3-13H,15H2,1-2H3,(H,29,30)/b19-11+ |
| InChIKey | GOQUGHVOBZVAQR-YBFXNURJSA-N |
| XLogP | 6.44 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|