C27H24N2O5 — CID 5130129
4-[[4-[2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 5130129) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is 4-[[4-[2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 5130129 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 4-[[4-[2-cyano-3-(4-methylanilino)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2ccc(C)cc2)ccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H24N2O5/c1-3-33-25-15-20(14-22(16-28)26(30)29-23-11-4-18(2)5-12-23)8-13-24(25)34-17-19-6-9-21(10-7-19)27(31)32/h4-15H,3,17H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | DIBJRNKXEFNFNC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|