C24H16Cl2NO4- — CID 2202747
4-[[2-chloro-4-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]-6-methoxyphenoxy]methyl]benzoate (PubChem CID 2202747) has the molecular formula C24H16Cl2NO4- and a molecular weight of 453.30 g/mol. Its IUPAC name is 4-[[2-chloro-4-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]-6-methoxyphenoxy]methyl]benzoate.
| Compound Name | 4-[[2-chloro-4-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]-6-methoxyphenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 2202747 |
| Molecular Formula | C24H16Cl2NO4- |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 4-[[2-chloro-4-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]-6-methoxyphenoxy]methyl]benzoate |
| SMILES | COc1cc(/C=C(/C#N)c2ccc(Cl)cc2)cc(Cl)c1OCc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C24H17Cl2NO4/c1-30-22-12-16(10-19(13-27)17-6-8-20(25)9-7-17)11-21(26)23(22)31-14-15-2-4-18(5-3-15)24(28)29/h2-12H,14H2,1H3,(H,28,29)/p-1/b19-10- |
| InChIKey | XDSPRMBJDINNDD-GRSHGNNSSA-M |
| XLogP | 5.01 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|