C20H17ClNO4- — CID 7368582
4-[(E)-2-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-1-cyanoethenyl]benzoate (PubChem CID 7368582) has the molecular formula C20H17ClNO4- and a molecular weight of 370.81 g/mol. Its IUPAC name is 4-[(E)-2-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-1-cyanoethenyl]benzoate.
| Compound Name | 4-[(E)-2-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-1-cyanoethenyl]benzoate |
|---|---|
| PubChem CID | 7368582 |
| Molecular Formula | C20H17ClNO4- |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 4-[(E)-2-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-1-cyanoethenyl]benzoate |
| SMILES | COc1cc(/C=C(/C#N)c2ccc(C(=O)[O-])cc2)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C20H18ClNO4/c1-12(2)26-19-17(21)9-13(10-18(19)25-3)8-16(11-22)14-4-6-15(7-5-14)20(23)24/h4-10,12H,1-3H3,(H,23,24)/p-1/b16-8- |
| InChIKey | ZTYUCAITJIFZOH-PXNMLYILSA-M |
| XLogP | 3.56 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|