C20H17ClNO3- — CID 2239101
4-[(E)-2-[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]-1-cyanoethenyl]benzoate (PubChem CID 2239101) has the molecular formula C20H17ClNO3- and a molecular weight of 354.81 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]-1-cyanoethenyl]benzoate.
| Compound Name | 4-[(E)-2-[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]-1-cyanoethenyl]benzoate |
|---|---|
| PubChem CID | 2239101 |
| Molecular Formula | C20H17ClNO3- |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 4-[(E)-2-[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]-1-cyanoethenyl]benzoate |
| SMILES | CC[C@H](C)Oc1ccc(/C=C(/C#N)c2ccc(C(=O)[O-])cc2)cc1Cl |
| InChI | InChI=1S/C20H18ClNO3/c1-3-13(2)25-19-9-4-14(11-18(19)21)10-17(12-22)15-5-7-16(8-6-15)20(23)24/h4-11,13H,3H2,1-2H3,(H,23,24)/p-1/b17-10-/t13-/m0/s1 |
| InChIKey | LXCKUPKXTKPQQN-NWRYFCBHSA-M |
| XLogP | 3.94 |
| TPSA | 73.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|