C19H16NO3- — CID 7372122
4-[(E)-1-cyano-2-(4-propan-2-yloxyphenyl)ethenyl]benzoate (PubChem CID 7372122) has the molecular formula C19H16NO3- and a molecular weight of 306.34 g/mol. Its IUPAC name is 4-[(E)-1-cyano-2-(4-propan-2-yloxyphenyl)ethenyl]benzoate.
| Compound Name | 4-[(E)-1-cyano-2-(4-propan-2-yloxyphenyl)ethenyl]benzoate |
|---|---|
| PubChem CID | 7372122 |
| Molecular Formula | C19H16NO3- |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 4-[(E)-1-cyano-2-(4-propan-2-yloxyphenyl)ethenyl]benzoate |
| SMILES | CC(C)Oc1ccc(/C=C(/C#N)c2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H17NO3/c1-13(2)23-18-9-3-14(4-10-18)11-17(12-20)15-5-7-16(8-6-15)19(21)22/h3-11,13H,1-2H3,(H,21,22)/p-1/b17-11- |
| InChIKey | MEGFPCIWEXBFBX-BOPFTXTBSA-M |
| XLogP | 2.90 |
| TPSA | 73.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|