C17H11NO4 — CID 6256221
4-[(Z)-2-(4-carboxyphenyl)-2-cyanoethenyl]benzoic acid (PubChem CID 6256221) has the molecular formula C17H11NO4 and a molecular weight of 293.28 g/mol. Its IUPAC name is 4-[(Z)-2-(4-carboxyphenyl)-2-cyanoethenyl]benzoic acid.
| Compound Name | 4-[(Z)-2-(4-carboxyphenyl)-2-cyanoethenyl]benzoic acid |
|---|---|
| PubChem CID | 6256221 |
| Molecular Formula | C17H11NO4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 4-[(Z)-2-(4-carboxyphenyl)-2-cyanoethenyl]benzoic acid |
| SMILES | N#C/C(=C\c1ccc(C(=O)O)cc1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H11NO4/c18-10-15(12-5-7-14(8-6-12)17(21)22)9-11-1-3-13(4-2-11)16(19)20/h1-9H,(H,19,20)(H,21,22)/b15-9+ |
| InChIKey | LPUPEZMAZAMZOV-OQLLNIDSSA-N |
| XLogP | 3.15 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|