C18H9F6NO2 — CID 102527853
4-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]-1-cyanoethenyl]benzoic acid (PubChem CID 102527853) has the molecular formula C18H9F6NO2 and a molecular weight of 385.26 g/mol. Its IUPAC name is 4-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]-1-cyanoethenyl]benzoic acid.
| Compound Name | 4-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]-1-cyanoethenyl]benzoic acid |
|---|---|
| PubChem CID | 102527853 |
| Molecular Formula | C18H9F6NO2 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 4-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]-1-cyanoethenyl]benzoic acid |
| SMILES | N#C/C(=C\c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H9F6NO2/c19-17(20,21)14-6-10(7-15(8-14)18(22,23)24)5-13(9-25)11-1-3-12(4-2-11)16(26)27/h1-8H,(H,26,27)/b13-5+ |
| InChIKey | LPSPVXULMJXGGS-WLRTZDKTSA-N |
| XLogP | 5.49 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|