C18H14F3NO — CID 124549989
(E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 124549989) has the molecular formula C18H14F3NO and a molecular weight of 317.31 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile.
| Compound Name | (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 124549989 |
| Molecular Formula | C18H14F3NO |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (E)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(/C#N)c2cccc(C(F)(F)F)c2)cc(C)c1O |
| InChI | InChI=1S/C18H14F3NO/c1-11-6-13(7-12(2)17(11)23)8-15(10-22)14-4-3-5-16(9-14)18(19,20)21/h3-9,23H,1-2H3/b15-8- |
| InChIKey | KMMLAHHRLHGYLE-NVNXTCNLSA-N |
| XLogP | 5.09 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|