C21H18F4N2 — CID 5145578
3-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 5145578) has the molecular formula C21H18F4N2 and a molecular weight of 374.38 g/mol. Its IUPAC name is 3-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile.
| Compound Name | 3-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 5145578 |
| Molecular Formula | C21H18F4N2 |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | Cc1cc(N2CCCC2)c(F)cc1C=C(C#N)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F4N2/c1-14-9-20(27-7-2-3-8-27)19(22)12-16(14)10-17(13-26)15-5-4-6-18(11-15)21(23,24)25/h4-6,9-12H,2-3,7-8H2,1H3 |
| InChIKey | GXKUKBKWGOAEAJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|