C21H19FN4 — CID 3410416
2-(1H-benzimidazol-2-yl)-3-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)prop-2-enenitrile (PubChem CID 3410416) has the molecular formula C21H19FN4 and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3410416 |
| Molecular Formula | C21H19FN4 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)prop-2-enenitrile |
| SMILES | Cc1cc(N2CCCC2)c(F)cc1C=C(C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H19FN4/c1-14-10-20(26-8-4-5-9-26)17(22)12-15(14)11-16(13-23)21-24-18-6-2-3-7-19(18)25-21/h2-3,6-7,10-12H,4-5,8-9H2,1H3,(H,24,25) |
| InChIKey | SURSCVKLGZYEFH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|