C19H14N4 — CID 3136514
2-(1H-benzimidazol-2-yl)-3-(2-methyl-1H-indol-3-yl)prop-2-enenitrile (PubChem CID 3136514) has the molecular formula C19H14N4 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-(2-methyl-1H-indol-3-yl)prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-(2-methyl-1H-indol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3136514 |
| Molecular Formula | C19H14N4 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-(2-methyl-1H-indol-3-yl)prop-2-enenitrile |
| SMILES | Cc1[nH]c2ccccc2c1C=C(C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H14N4/c1-12-15(14-6-2-3-7-16(14)21-12)10-13(11-20)19-22-17-8-4-5-9-18(17)23-19/h2-10,21H,1H3,(H,22,23) |
| InChIKey | QEFKYRXEYOKDAP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|