C17H13N3 — CID 2789977
2-(1H-benzimidazol-2-yl)-3-(4-methylphenyl)prop-2-enenitrile (PubChem CID 2789977) has the molecular formula C17H13N3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2789977 |
| Molecular Formula | C17H13N3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-(4-methylphenyl)prop-2-enenitrile |
| SMILES | Cc1ccc(C=C(C#N)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C17H13N3/c1-12-6-8-13(9-7-12)10-14(11-18)17-19-15-4-2-3-5-16(15)20-17/h2-10H,1H3,(H,19,20) |
| InChIKey | KMNSBYJUTHMOPK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|