C32H30N4O — CID 139178886
(E)-2-(1H-benzimidazol-2-yl)-3-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]prop-2-enenitrile;ethanol (PubChem CID 139178886) has the molecular formula C32H30N4O and a molecular weight of 486.62 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]prop-2-enenitrile;ethanol.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]prop-2-enenitrile;ethanol |
|---|---|
| PubChem CID | 139178886 |
| Molecular Formula | C32H30N4O |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]prop-2-enenitrile;ethanol |
| SMILES | CCO.Cc1ccc(N(c2ccc(C)cc2)c2ccc(/C=C(\C#N)c3nc4ccccc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C30H24N4.C2H6O/c1-21-7-13-25(14-8-21)34(26-15-9-22(2)10-16-26)27-17-11-23(12-18-27)19-24(20-31)30-32-28-5-3-4-6-29(28)33-30;1-2-3/h3-19H,1-2H3,(H,32,33);3H,2H2,1H3/b24-19+; |
| InChIKey | VLEAFMVIJZYWQB-UUWMJBOLSA-N |
| XLogP | 7.71 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|