C19H19ClN4 — CID 163327257
(Z)-3-[4-(dimethylamino)phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile;hydrochloride (PubChem CID 163327257) has the molecular formula C19H19ClN4 and a molecular weight of 338.84 g/mol. Its IUPAC name is (Z)-3-[4-(dimethylamino)phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile;hydrochloride.
| Compound Name | (Z)-3-[4-(dimethylamino)phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 163327257 |
| Molecular Formula | C19H19ClN4 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (Z)-3-[4-(dimethylamino)phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile;hydrochloride |
| SMILES | Cc1ccc2nc(/C(C#N)=C\c3ccc(N(C)C)cc3)[nH]c2c1.Cl |
| InChI | InChI=1S/C19H18N4.ClH/c1-13-4-9-17-18(10-13)22-19(21-17)15(12-20)11-14-5-7-16(8-6-14)23(2)3;/h4-11H,1-3H3,(H,21,22);1H/b15-11-; |
| InChIKey | UTQBYFYHWSDBIE-PNCOJPCNSA-N |
| XLogP | 4.42 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|