C20H17N3O — CID 3963933
2-(6-methyl-1H-benzimidazol-2-yl)-3-(4-prop-2-enoxyphenyl)prop-2-enenitrile (PubChem CID 3963933) has the molecular formula C20H17N3O and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-(6-methyl-1H-benzimidazol-2-yl)-3-(4-prop-2-enoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(6-methyl-1H-benzimidazol-2-yl)-3-(4-prop-2-enoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3963933 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-(6-methyl-1H-benzimidazol-2-yl)-3-(4-prop-2-enoxyphenyl)prop-2-enenitrile |
| SMILES | C=CCOc1ccc(C=C(C#N)c2nc3ccc(C)cc3[nH]2)cc1 |
| InChI | InChI=1S/C20H17N3O/c1-3-10-24-17-7-5-15(6-8-17)12-16(13-21)20-22-18-9-4-14(2)11-19(18)23-20/h3-9,11-12H,1,10H2,2H3,(H,22,23) |
| InChIKey | VKMWGCITXNLQMM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|