C20H19N3O — CID 83476511
(E)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)-3-(4-ethoxyphenyl)prop-2-enenitrile (PubChem CID 83476511) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is (E)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)-3-(4-ethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)-3-(4-ethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 83476511 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (E)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)-3-(4-ethoxyphenyl)prop-2-enenitrile |
| SMILES | CCOc1ccc(/C=C(\C#N)c2nc3cc(C)c(C)cc3[nH]2)cc1 |
| InChI | InChI=1S/C20H19N3O/c1-4-24-17-7-5-15(6-8-17)11-16(12-21)20-22-18-9-13(2)14(3)10-19(18)23-20/h5-11H,4H2,1-3H3,(H,22,23)/b16-11+ |
| InChIKey | IUCDDIDGYCLVMS-LFIBNONCSA-N |
| XLogP | 4.64 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|