C25H19Br2N3O — CID 126192558
(Z)-3-[4-[(2,4-dibromophenyl)methoxy]phenyl]-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 126192558) has the molecular formula C25H19Br2N3O and a molecular weight of 537.26 g/mol. Its IUPAC name is (Z)-3-[4-[(2,4-dibromophenyl)methoxy]phenyl]-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[(2,4-dibromophenyl)methoxy]phenyl]-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126192558 |
| Molecular Formula | C25H19Br2N3O |
| Molecular Weight | 537.26 g/mol |
| Exact Mass | 534.99 |
| IUPAC Name | (Z)-3-[4-[(2,4-dibromophenyl)methoxy]phenyl]-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1cc2nc(/C(C#N)=C\c3ccc(OCc4ccc(Br)cc4Br)cc3)[nH]c2cc1C |
| InChI | InChI=1S/C25H19Br2N3O/c1-15-9-23-24(10-16(15)2)30-25(29-23)19(13-28)11-17-3-7-21(8-4-17)31-14-18-5-6-20(26)12-22(18)27/h3-12H,14H2,1-2H3,(H,29,30)/b19-11- |
| InChIKey | ADBFLVCRBGEEFY-ODLFYWEKSA-N |
| XLogP | 7.35 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.26 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|