C27H32ClN3O — CID 110529960
(Z)-3-(2-chloro-4-nonoxyphenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 110529960) has the molecular formula C27H32ClN3O and a molecular weight of 450.03 g/mol. Its IUPAC name is (Z)-3-(2-chloro-4-nonoxyphenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(2-chloro-4-nonoxyphenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110529960 |
| Molecular Formula | C27H32ClN3O |
| Molecular Weight | 450.03 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (Z)-3-(2-chloro-4-nonoxyphenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | CCCCCCCCCOc1ccc(/C=C(/C#N)c2nc3cc(C)c(C)cc3[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C27H32ClN3O/c1-4-5-6-7-8-9-10-13-32-23-12-11-21(24(28)17-23)16-22(18-29)27-30-25-14-19(2)20(3)15-26(25)31-27/h11-12,14-17H,4-10,13H2,1-3H3,(H,30,31)/b22-16- |
| InChIKey | GJLVRZCYKDJWDF-JWGURIENSA-N |
| XLogP | 8.03 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.03 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|