C21H21N3O — CID 110537057
(Z)-3-(3-butoxyphenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 110537057) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is (Z)-3-(3-butoxyphenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3-butoxyphenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110537057 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (Z)-3-(3-butoxyphenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | CCCCOc1cccc(/C=C(/C#N)c2nc3ccc(C)cc3[nH]2)c1 |
| InChI | InChI=1S/C21H21N3O/c1-3-4-10-25-18-7-5-6-16(13-18)12-17(14-22)21-23-19-9-8-15(2)11-20(19)24-21/h5-9,11-13H,3-4,10H2,1-2H3,(H,23,24)/b17-12- |
| InChIKey | HIKXQKMOJXLJLS-ATVHPVEESA-N |
| XLogP | 5.11 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|