C22H22BrN3O2 — CID 50886479
(Z)-3-(3-bromo-4-butoxy-5-methoxyphenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 50886479) has the molecular formula C22H22BrN3O2 and a molecular weight of 440.34 g/mol. Its IUPAC name is (Z)-3-(3-bromo-4-butoxy-5-methoxyphenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3-bromo-4-butoxy-5-methoxyphenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 50886479 |
| Molecular Formula | C22H22BrN3O2 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | (Z)-3-(3-bromo-4-butoxy-5-methoxyphenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | CCCCOc1c(Br)cc(/C=C(/C#N)c2nc3ccc(C)cc3[nH]2)cc1OC |
| InChI | InChI=1S/C22H22BrN3O2/c1-4-5-8-28-21-17(23)11-15(12-20(21)27-3)10-16(13-24)22-25-18-7-6-14(2)9-19(18)26-22/h6-7,9-12H,4-5,8H2,1-3H3,(H,25,26)/b16-10- |
| InChIKey | XCOJLGVEUHPAMX-YBEGLDIGSA-N |
| XLogP | 5.89 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|