C21H21BrClN3O2 — CID 46741686
(E)-3-(3-bromo-5-methoxy-4-propoxyphenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile;hydrochloride (PubChem CID 46741686) has the molecular formula C21H21BrClN3O2 and a molecular weight of 462.78 g/mol. Its IUPAC name is (E)-3-(3-bromo-5-methoxy-4-propoxyphenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile;hydrochloride.
| Compound Name | (E)-3-(3-bromo-5-methoxy-4-propoxyphenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 46741686 |
| Molecular Formula | C21H21BrClN3O2 |
| Molecular Weight | 462.78 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | (E)-3-(3-bromo-5-methoxy-4-propoxyphenyl)-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile;hydrochloride |
| SMILES | CCCOc1c(Br)cc(/C=C(\C#N)c2nc3ccc(C)cc3[nH]2)cc1OC.Cl |
| InChI | InChI=1S/C21H20BrN3O2.ClH/c1-4-7-27-20-16(22)10-14(11-19(20)26-3)9-15(12-23)21-24-17-6-5-13(2)8-18(17)25-21;/h5-6,8-11H,4,7H2,1-3H3,(H,24,25);1H/b15-9+; |
| InChIKey | LRGQJMVIOGRFRW-NSPIFIKESA-N |
| XLogP | 5.92 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.78 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|