C17H13N3O — CID 86775933
(Z)-2-(1H-benzimidazol-2-yl)-3-(3-methoxyphenyl)prop-2-enenitrile (PubChem CID 86775933) has the molecular formula C17H13N3O and a molecular weight of 275.31 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-(3-methoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-(3-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 86775933 |
| Molecular Formula | C17H13N3O |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-(3-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cccc(/C=C(/C#N)c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C17H13N3O/c1-21-14-6-4-5-12(10-14)9-13(11-18)17-19-15-7-2-3-8-16(15)20-17/h2-10H,1H3,(H,19,20)/b13-9- |
| InChIKey | RDSCFLMCSMCAAM-LCYFTJDESA-N |
| XLogP | 3.64 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|