C23H17N3O2 — CID 126396585
(Z)-2-(6-methoxy-1H-benzimidazol-2-yl)-3-(3-phenoxyphenyl)prop-2-enenitrile (PubChem CID 126396585) has the molecular formula C23H17N3O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is (Z)-2-(6-methoxy-1H-benzimidazol-2-yl)-3-(3-phenoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(6-methoxy-1H-benzimidazol-2-yl)-3-(3-phenoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126396585 |
| Molecular Formula | C23H17N3O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (Z)-2-(6-methoxy-1H-benzimidazol-2-yl)-3-(3-phenoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc2nc(/C(C#N)=C\c3cccc(Oc4ccccc4)c3)[nH]c2c1 |
| InChI | InChI=1S/C23H17N3O2/c1-27-19-10-11-21-22(14-19)26-23(25-21)17(15-24)12-16-6-5-9-20(13-16)28-18-7-3-2-4-8-18/h2-14H,1H3,(H,25,26)/b17-12- |
| InChIKey | NHSSKRUETPNEOW-ATVHPVEESA-N |
| XLogP | 5.43 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|