C17H15NO2 — CID 10945343
(Z)-2,3-bis(3-methoxyphenyl)prop-2-enenitrile (PubChem CID 10945343) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is (Z)-2,3-bis(3-methoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2,3-bis(3-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 10945343 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (Z)-2,3-bis(3-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cccc(/C=C(\C#N)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C17H15NO2/c1-19-16-7-3-5-13(10-16)9-15(12-18)14-6-4-8-17(11-14)20-2/h3-11H,1-2H3/b15-9+ |
| InChIKey | OTOIYBZTPYXYHZ-OQLLNIDSSA-N |
| XLogP | 3.77 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|