C22H23NO4 — CID 39115301
[3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 39115301) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 39115301 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc(/C(C#N)=C\c2cccc(OC(=O)C(C)(C)C)c2)cc1OC |
| InChI | InChI=1S/C22H23NO4/c1-22(2,3)21(24)27-18-8-6-7-15(12-18)11-17(14-23)16-9-10-19(25-4)20(13-16)26-5/h6-13H,1-5H3/b17-11- |
| InChIKey | YLTPIOGDWVDWFH-BOPFTXTBSA-N |
| XLogP | 4.72 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|