C31H25NO4 — CID 39115328
[3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2,2-diphenylacetate (PubChem CID 39115328) has the molecular formula C31H25NO4 and a molecular weight of 475.54 g/mol. Its IUPAC name is [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2,2-diphenylacetate.
| Compound Name | [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 39115328 |
| Molecular Formula | C31H25NO4 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2,2-diphenylacetate |
| SMILES | COc1ccc(/C(C#N)=C\c2cccc(OC(=O)C(c3ccccc3)c3ccccc3)c2)cc1OC |
| InChI | InChI=1S/C31H25NO4/c1-34-28-17-16-25(20-29(28)35-2)26(21-32)18-22-10-9-15-27(19-22)36-31(33)30(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h3-20,30H,1-2H3/b26-18- |
| InChIKey | IKHPRHMZKAVKPO-ITYLOYPMSA-N |
| XLogP | 6.51 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|