C21H21NO4 — CID 39115300
[3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2-methylpropanoate (PubChem CID 39115300) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2-methylpropanoate.
| Compound Name | [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 39115300 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2-methylpropanoate |
| SMILES | COc1ccc(/C(C#N)=C\c2cccc(OC(=O)C(C)C)c2)cc1OC |
| InChI | InChI=1S/C21H21NO4/c1-14(2)21(23)26-18-7-5-6-15(11-18)10-17(13-22)16-8-9-19(24-3)20(12-16)25-4/h5-12,14H,1-4H3/b17-10- |
| InChIKey | SEKUQBOQQDKGMU-YVLHZVERSA-N |
| XLogP | 4.33 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|