C21H21NO3 — CID 19170617
[4-[(Z)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 2,2-dimethylpropanoate (PubChem CID 19170617) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(Z)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 19170617 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | [4-[(Z)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 2,2-dimethylpropanoate |
| SMILES | COc1cc(/C=C(\C#N)c2ccccc2)ccc1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H21NO3/c1-21(2,3)20(23)25-18-11-10-15(13-19(18)24-4)12-17(14-22)16-8-6-5-7-9-16/h5-13H,1-4H3/b17-12+ |
| InChIKey | DHSNSZQORSVSMQ-SFQUDFHCSA-N |
| XLogP | 4.71 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|