C25H19Br2NO3 — CID 19170621
[4-[(Z)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 2,3-dibromo-3-phenylpropanoate (PubChem CID 19170621) has the molecular formula C25H19Br2NO3 and a molecular weight of 541.24 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 2,3-dibromo-3-phenylpropanoate.
| Compound Name | [4-[(Z)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 2,3-dibromo-3-phenylpropanoate |
|---|---|
| PubChem CID | 19170621 |
| Molecular Formula | C25H19Br2NO3 |
| Molecular Weight | 541.24 g/mol |
| Exact Mass | 538.97 |
| IUPAC Name | [4-[(Z)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 2,3-dibromo-3-phenylpropanoate |
| SMILES | COc1cc(/C=C(\C#N)c2ccccc2)ccc1OC(=O)C(Br)C(Br)c1ccccc1 |
| InChI | InChI=1S/C25H19Br2NO3/c1-30-22-15-17(14-20(16-28)18-8-4-2-5-9-18)12-13-21(22)31-25(29)24(27)23(26)19-10-6-3-7-11-19/h2-15,23-24H,1H3/b20-14+ |
| InChIKey | DJQQKYCOJMWPGV-XSFVSMFZSA-N |
| XLogP | 6.56 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.24 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|