C27H20N2O5 — CID 23997169
[4-(2-cyano-2-phenylethenyl)-2-methoxyphenyl] 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 23997169) has the molecular formula C27H20N2O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is [4-(2-cyano-2-phenylethenyl)-2-methoxyphenyl] 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [4-(2-cyano-2-phenylethenyl)-2-methoxyphenyl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 23997169 |
| Molecular Formula | C27H20N2O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [4-(2-cyano-2-phenylethenyl)-2-methoxyphenyl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | COc1cc(C=C(C#N)c2ccccc2)ccc1OC(=O)C(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H20N2O5/c1-17(29-25(30)21-10-6-7-11-22(21)26(29)31)27(32)34-23-13-12-18(15-24(23)33-2)14-20(16-28)19-8-4-3-5-9-19/h3-15,17H,1-2H3 |
| InChIKey | NNNOBDZHLUEOCR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|