C24H17Cl2NO4 — CID 39114296
[4-[(E)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 39114296) has the molecular formula C24H17Cl2NO4 and a molecular weight of 454.31 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [4-[(E)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 39114296 |
| Molecular Formula | C24H17Cl2NO4 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | [4-[(E)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | COc1cc(/C=C(/C#N)c2ccccc2)ccc1OC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H17Cl2NO4/c1-29-23-12-16(11-18(14-27)17-5-3-2-4-6-17)7-9-22(23)31-24(28)15-30-21-10-8-19(25)13-20(21)26/h2-13H,15H2,1H3/b18-11- |
| InChIKey | ADKULXLXIFYRRK-WQRHYEAKSA-N |
| XLogP | 6.05 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|