C18H13Cl2NO4 — CID 19227656
[4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 19227656) has the molecular formula C18H13Cl2NO4 and a molecular weight of 378.21 g/mol. Its IUPAC name is [4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 19227656 |
| Molecular Formula | C18H13Cl2NO4 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | [4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | COc1cc(/C=C\C#N)ccc1OC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl2NO4/c1-23-17-9-12(3-2-8-21)4-6-16(17)25-18(22)11-24-15-7-5-13(19)10-14(15)20/h2-7,9-10H,11H2,1H3/b3-2- |
| InChIKey | GJKFDRSTTLQABX-IHWYPQMZSA-N |
| XLogP | 4.52 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|