C20H19NO4 — CID 19228110
[4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 4-phenoxybutanoate (PubChem CID 19228110) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is [4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 4-phenoxybutanoate.
| Compound Name | [4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 4-phenoxybutanoate |
|---|---|
| PubChem CID | 19228110 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 4-phenoxybutanoate |
| SMILES | COc1cc(/C=C\C#N)ccc1OC(=O)CCCOc1ccccc1 |
| InChI | InChI=1S/C20H19NO4/c1-23-19-15-16(7-5-13-21)11-12-18(19)25-20(22)10-6-14-24-17-8-3-2-4-9-17/h2-5,7-9,11-12,15H,6,10,14H2,1H3/b7-5- |
| InChIKey | KYZSNULFDXRABH-ALCCZGGFSA-N |
| XLogP | 4.00 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|