C20H18ClNO4 — CID 19228180
[4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 4-(4-chlorophenoxy)butanoate (PubChem CID 19228180) has the molecular formula C20H18ClNO4 and a molecular weight of 371.82 g/mol. Its IUPAC name is [4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 4-(4-chlorophenoxy)butanoate.
| Compound Name | [4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 4-(4-chlorophenoxy)butanoate |
|---|---|
| PubChem CID | 19228180 |
| Molecular Formula | C20H18ClNO4 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | [4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 4-(4-chlorophenoxy)butanoate |
| SMILES | COc1cc(/C=C\C#N)ccc1OC(=O)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClNO4/c1-24-19-14-15(4-2-12-22)6-11-18(19)26-20(23)5-3-13-25-17-9-7-16(21)8-10-17/h2,4,6-11,14H,3,5,13H2,1H3/b4-2- |
| InChIKey | GXOHVXLPHIPKTI-RQOWECAXSA-N |
| XLogP | 4.65 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|