C24H26BrNO4 — CID 19228704
[4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 4-(2-bromo-4-tert-butylphenoxy)butanoate (PubChem CID 19228704) has the molecular formula C24H26BrNO4 and a molecular weight of 472.38 g/mol. Its IUPAC name is [4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 4-(2-bromo-4-tert-butylphenoxy)butanoate.
| Compound Name | [4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 4-(2-bromo-4-tert-butylphenoxy)butanoate |
|---|---|
| PubChem CID | 19228704 |
| Molecular Formula | C24H26BrNO4 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | [4-[(Z)-2-cyanoethenyl]-2-methoxyphenyl] 4-(2-bromo-4-tert-butylphenoxy)butanoate |
| SMILES | COc1cc(/C=C\C#N)ccc1OC(=O)CCCOc1ccc(C(C)(C)C)cc1Br |
| InChI | InChI=1S/C24H26BrNO4/c1-24(2,3)18-10-12-20(19(25)16-18)29-14-6-8-23(27)30-21-11-9-17(7-5-13-26)15-22(21)28-4/h5,7,9-12,15-16H,6,8,14H2,1-4H3/b7-5- |
| InChIKey | XORQZSGTHYNWAQ-ALCCZGGFSA-N |
| XLogP | 6.06 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|