C22H25BrN2O5 — CID 108757356
methyl 5-[4-(2-bromo-4-tert-butylphenoxy)butanoylamino]-4-cyano-2-methylfuran-3-carboxylate (PubChem CID 108757356) has the molecular formula C22H25BrN2O5 and a molecular weight of 477.36 g/mol. Its IUPAC name is methyl 5-[4-(2-bromo-4-tert-butylphenoxy)butanoylamino]-4-cyano-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[4-(2-bromo-4-tert-butylphenoxy)butanoylamino]-4-cyano-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108757356 |
| Molecular Formula | C22H25BrN2O5 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | methyl 5-[4-(2-bromo-4-tert-butylphenoxy)butanoylamino]-4-cyano-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(NC(=O)CCCOc2ccc(C(C)(C)C)cc2Br)c1C#N |
| InChI | InChI=1S/C22H25BrN2O5/c1-13-19(21(27)28-5)15(12-24)20(30-13)25-18(26)7-6-10-29-17-9-8-14(11-16(17)23)22(2,3)4/h8-9,11H,6-7,10H2,1-5H3,(H,25,26) |
| InChIKey | BZQQCHDJJNIJJT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|