C10H10N2O4 — CID 108733946
methyl 5-acetamido-4-cyano-2-methylfuran-3-carboxylate (PubChem CID 108733946) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is methyl 5-acetamido-4-cyano-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-acetamido-4-cyano-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108733946 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | methyl 5-acetamido-4-cyano-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(NC(C)=O)c1C#N |
| InChI | InChI=1S/C10H10N2O4/c1-5-8(10(14)15-3)7(4-11)9(16-5)12-6(2)13/h1-3H3,(H,12,13) |
| InChIKey | QEOSCXHUTYDFLB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |