C15H11FN2O4 — CID 108757235
methyl 4-cyano-5-[(2-fluorobenzoyl)amino]-2-methylfuran-3-carboxylate (PubChem CID 108757235) has the molecular formula C15H11FN2O4 and a molecular weight of 302.26 g/mol. Its IUPAC name is methyl 4-cyano-5-[(2-fluorobenzoyl)amino]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 4-cyano-5-[(2-fluorobenzoyl)amino]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108757235 |
| Molecular Formula | C15H11FN2O4 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | methyl 4-cyano-5-[(2-fluorobenzoyl)amino]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(NC(=O)c2ccccc2F)c1C#N |
| InChI | InChI=1S/C15H11FN2O4/c1-8-12(15(20)21-2)10(7-17)14(22-8)18-13(19)9-5-3-4-6-11(9)16/h3-6H,1-2H3,(H,18,19) |
| InChIKey | LSVINEWOBHTUHA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |