C17H15N3O5 — CID 108757369
methyl 5-[(3-acetamidobenzoyl)amino]-4-cyano-2-methylfuran-3-carboxylate (PubChem CID 108757369) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is methyl 5-[(3-acetamidobenzoyl)amino]-4-cyano-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(3-acetamidobenzoyl)amino]-4-cyano-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108757369 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | methyl 5-[(3-acetamidobenzoyl)amino]-4-cyano-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(NC(=O)c2cccc(NC(C)=O)c2)c1C#N |
| InChI | InChI=1S/C17H15N3O5/c1-9-14(17(23)24-3)13(8-18)16(25-9)20-15(22)11-5-4-6-12(7-11)19-10(2)21/h4-7H,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | WSARTQWXZNLUQX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |