C14H11N3O4 — CID 108757223
methyl 4-cyano-2-methyl-5-(pyridine-3-carbonylamino)furan-3-carboxylate (PubChem CID 108757223) has the molecular formula C14H11N3O4 and a molecular weight of 285.26 g/mol. Its IUPAC name is methyl 4-cyano-2-methyl-5-(pyridine-3-carbonylamino)furan-3-carboxylate.
| Compound Name | methyl 4-cyano-2-methyl-5-(pyridine-3-carbonylamino)furan-3-carboxylate |
|---|---|
| PubChem CID | 108757223 |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | methyl 4-cyano-2-methyl-5-(pyridine-3-carbonylamino)furan-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(NC(=O)c2cccnc2)c1C#N |
| InChI | InChI=1S/C14H11N3O4/c1-8-11(14(19)20-2)10(6-15)13(21-8)17-12(18)9-4-3-5-16-7-9/h3-5,7H,1-2H3,(H,17,18) |
| InChIKey | QHNZOOBYPGSIII-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |