C16H16N2O4 — CID 108762746
N-(3-cyano-4,5-dimethylfuran-2-yl)-3,5-dimethoxybenzamide (PubChem CID 108762746) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylfuran-2-yl)-3,5-dimethoxybenzamide.
| Compound Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 108762746 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2oc(C)c(C)c2C#N)c1 |
| InChI | InChI=1S/C16H16N2O4/c1-9-10(2)22-16(14(9)8-17)18-15(19)11-5-12(20-3)7-13(6-11)21-4/h5-7H,1-4H3,(H,18,19) |
| InChIKey | OERDNABFDMPQCR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |