C14H11IN2O2 — CID 108762743
N-(3-cyano-4,5-dimethylfuran-2-yl)-2-iodobenzamide (PubChem CID 108762743) has the molecular formula C14H11IN2O2 and a molecular weight of 366.16 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylfuran-2-yl)-2-iodobenzamide.
| Compound Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-2-iodobenzamide |
|---|---|
| PubChem CID | 108762743 |
| Molecular Formula | C14H11IN2O2 |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-2-iodobenzamide |
| SMILES | Cc1oc(NC(=O)c2ccccc2I)c(C#N)c1C |
| InChI | InChI=1S/C14H11IN2O2/c1-8-9(2)19-14(11(8)7-16)17-13(18)10-5-3-4-6-12(10)15/h3-6H,1-2H3,(H,17,18) |
| InChIKey | HSMTVQCLMLJCEK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|