C14H10ClN3O4 — CID 108740165
2-chloro-N-(3-cyano-4,5-dimethylfuran-2-yl)-5-nitrobenzamide (PubChem CID 108740165) has the molecular formula C14H10ClN3O4 and a molecular weight of 319.70 g/mol. Its IUPAC name is 2-chloro-N-(3-cyano-4,5-dimethylfuran-2-yl)-5-nitrobenzamide.
| Compound Name | 2-chloro-N-(3-cyano-4,5-dimethylfuran-2-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 108740165 |
| Molecular Formula | C14H10ClN3O4 |
| Molecular Weight | 319.70 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-chloro-N-(3-cyano-4,5-dimethylfuran-2-yl)-5-nitrobenzamide |
| SMILES | Cc1oc(NC(=O)c2cc([N+](=O)[O-])ccc2Cl)c(C#N)c1C |
| InChI | InChI=1S/C14H10ClN3O4/c1-7-8(2)22-14(11(7)6-16)17-13(19)10-5-9(18(20)21)3-4-12(10)15/h3-5H,1-2H3,(H,17,19) |
| InChIKey | PYXDSKQLDDVSKY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.70 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|