C15H10ClN3O5S — CID 5066487
methyl 5-[(2-chloro-5-nitrobenzoyl)amino]-4-cyano-3-methylthiophene-2-carboxylate (PubChem CID 5066487) has the molecular formula C15H10ClN3O5S and a molecular weight of 379.78 g/mol. Its IUPAC name is methyl 5-[(2-chloro-5-nitrobenzoyl)amino]-4-cyano-3-methylthiophene-2-carboxylate.
| Compound Name | methyl 5-[(2-chloro-5-nitrobenzoyl)amino]-4-cyano-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 5066487 |
| Molecular Formula | C15H10ClN3O5S |
| Molecular Weight | 379.78 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | methyl 5-[(2-chloro-5-nitrobenzoyl)amino]-4-cyano-3-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(NC(=O)c2cc([N+](=O)[O-])ccc2Cl)c(C#N)c1C |
| InChI | InChI=1S/C15H10ClN3O5S/c1-7-10(6-17)14(25-12(7)15(21)24-2)18-13(20)9-5-8(19(22)23)3-4-11(9)16/h3-5H,1-2H3,(H,18,20) |
| InChIKey | IQVBJWOJZGEVOR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.78 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|