C14H11N3O3S — CID 4179547
N-(3-cyano-4,5-dimethylthiophen-2-yl)-3-nitrobenzamide (PubChem CID 4179547) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylthiophen-2-yl)-3-nitrobenzamide.
| Compound Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 4179547 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-3-nitrobenzamide |
| SMILES | Cc1sc(NC(=O)c2cccc([N+](=O)[O-])c2)c(C#N)c1C |
| InChI | InChI=1S/C14H11N3O3S/c1-8-9(2)21-14(12(8)7-15)16-13(18)10-4-3-5-11(6-10)17(19)20/h3-6H,1-2H3,(H,16,18) |
| InChIKey | YFMMIEKPZANGCF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|