C17H13N5O3S3 — CID 2229917
N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrobenzamide (PubChem CID 2229917) has the molecular formula C17H13N5O3S3 and a molecular weight of 431.52 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrobenzamide.
| Compound Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 2229917 |
| Molecular Formula | C17H13N5O3S3 |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrobenzamide |
| SMILES | Cc1nnc(Sc2ccc(C(=O)Nc3sc(C)c(C)c3C#N)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C17H13N5O3S3/c1-8-9(2)26-16(12(8)7-18)19-15(23)11-4-5-14(13(6-11)22(24)25)28-17-21-20-10(3)27-17/h4-6H,1-3H3,(H,19,23) |
| InChIKey | FKMZDMGSDNIEIV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|