C18H20N2O3S — CID 43981375
N-(3-cyano-4,5-dimethylthiophen-2-yl)-3,4-diethoxybenzamide (PubChem CID 43981375) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylthiophen-2-yl)-3,4-diethoxybenzamide.
| Compound Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 43981375 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2sc(C)c(C)c2C#N)cc1OCC |
| InChI | InChI=1S/C18H20N2O3S/c1-5-22-15-8-7-13(9-16(15)23-6-2)17(21)20-18-14(10-19)11(3)12(4)24-18/h7-9H,5-6H2,1-4H3,(H,20,21) |
| InChIKey | WAJLOODLBJKVMM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |